C24H23N3O2 — CID 53084634
1-[(3-methoxyphenyl)methyl]-N-(1-phenylethyl)indazole-6-carboxamide (PubChem CID 53084634) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-N-(1-phenylethyl)indazole-6-carboxamide.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-N-(1-phenylethyl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 53084634 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-N-(1-phenylethyl)indazole-6-carboxamide |
| SMILES | COc1cccc(Cn2ncc3ccc(C(=O)NC(C)c4ccccc4)cc32)c1 |
| InChI | InChI=1S/C24H23N3O2/c1-17(19-8-4-3-5-9-19)26-24(28)20-11-12-21-15-25-27(23(21)14-20)16-18-7-6-10-22(13-18)29-2/h3-15,17H,16H2,1-2H3,(H,26,28) |
| InChIKey | OFVISPLMBQZIRN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |