About ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate
ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate (PubChem CID 53086242) has the molecular formula C19H32N4O3
and a molecular weight of 364.49 g/mol. Its IUPAC name is ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate |
| PubChem CID | 53086242 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(NC(=O)NCCc2c(C)nn(C)c2C)CCCCC1 |
| InChI | InChI=1S/C19H32N4O3/c1-5-26-17(24)13-19(10-7-6-8-11-19)21-18(25)20-12-9-16-14(2)22-23(4)15(16)3/h5-13H2,1-4H3,(H2,20,21,25) |
| InChIKey | NZFORBIVRDIRSI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate?
The IUPAC name of ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate (CID 53086242) is ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate.
What is the SMILES notation for ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate?
The canonical SMILES for ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate is CCOC(=O)CC1(NC(=O)NCCc2c(C)nn(C)c2C)CCCCC1.
What is the InChIKey of ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate?
The InChIKey is NZFORBIVRDIRSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N4O3/c1-5-26-17(24)13-19(10-7-6-8-11-19)21-18(25)20-12-9-16-14(2)22-23(4)15(16)3/h5-13H2,1-4H3,(H2,20,21,25).
What are the key properties of ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate?
ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate has a molecular weight of 364.49 g/mol, XLogP of 2.53, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-[2-(1,3,5-trimethylpyrazol-4-yl)ethylcarbamoylamino]cyclohexyl]acetate is sourced from PubChem (CID 53086242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).