C21H19N3O2 — CID 53087009
6-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1-propylquinolin-4-one (PubChem CID 53087009) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 6-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1-propylquinolin-4-one.
| Compound Name | 6-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1-propylquinolin-4-one |
|---|---|
| PubChem CID | 53087009 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 6-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1-propylquinolin-4-one |
| SMILES | CCCn1cc(-c2nc(-c3ccccc3)no2)c(=O)c2cc(C)ccc21 |
| InChI | InChI=1S/C21H19N3O2/c1-3-11-24-13-17(19(25)16-12-14(2)9-10-18(16)24)21-22-20(23-26-21)15-7-5-4-6-8-15/h4-10,12-13H,3,11H2,1-2H3 |
| InChIKey | QLALNKNUDBRIKR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |