C18H29N3O3S — CID 53087255
N-cyclohexyl-1-methyl-4-(4-methylpiperidin-1-yl)sulfonylpyrrole-2-carboxamide (PubChem CID 53087255) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N-cyclohexyl-1-methyl-4-(4-methylpiperidin-1-yl)sulfonylpyrrole-2-carboxamide.
| Compound Name | N-cyclohexyl-1-methyl-4-(4-methylpiperidin-1-yl)sulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 53087255 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-cyclohexyl-1-methyl-4-(4-methylpiperidin-1-yl)sulfonylpyrrole-2-carboxamide |
| SMILES | CC1CCN(S(=O)(=O)c2cc(C(=O)NC3CCCCC3)n(C)c2)CC1 |
| InChI | InChI=1S/C18H29N3O3S/c1-14-8-10-21(11-9-14)25(23,24)16-12-17(20(2)13-16)18(22)19-15-6-4-3-5-7-15/h12-15H,3-11H2,1-2H3,(H,19,22) |
| InChIKey | OZOYIHCMMAQXDM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |