C24H27N3O5 — CID 5308768
ethyl 4-[1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-3-oxo-1H-isoindol-2-yl]piperidine-1-carboxylate (PubChem CID 5308768) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is ethyl 4-[1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-3-oxo-1H-isoindol-2-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-3-oxo-1H-isoindol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 5308768 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | ethyl 4-[1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-3-oxo-1H-isoindol-2-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)c3ccccc3C2Nc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C24H27N3O5/c1-2-30-24(29)26-11-9-17(10-12-26)27-22(18-5-3-4-6-19(18)23(27)28)25-16-7-8-20-21(15-16)32-14-13-31-20/h3-8,15,17,22,25H,2,9-14H2,1H3 |
| InChIKey | OOTYYBKURIDEQE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|