C24H30N4O4S — CID 53088454
N-(3,5-dimethylphenyl)-2-[3-(dimethylsulfamoyl)-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxalin-5-yl]acetamide (PubChem CID 53088454) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[3-(dimethylsulfamoyl)-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxalin-5-yl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[3-(dimethylsulfamoyl)-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxalin-5-yl]acetamide |
|---|---|
| PubChem CID | 53088454 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[3-(dimethylsulfamoyl)-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxalin-5-yl]acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CN2C(=O)C3CCCCN3c3ccc(S(=O)(=O)N(C)C)cc32)c1 |
| InChI | InChI=1S/C24H30N4O4S/c1-16-11-17(2)13-18(12-16)25-23(29)15-28-22-14-19(33(31,32)26(3)4)8-9-20(22)27-10-6-5-7-21(27)24(28)30/h8-9,11-14,21H,5-7,10,15H2,1-4H3,(H,25,29) |
| InChIKey | BBWUVWQGDCCUJM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |