C15H17ClN4O3 — CID 53088619
N-butyl-2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazine-6-carboxamide (PubChem CID 53088619) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is N-butyl-2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazine-6-carboxamide.
| Compound Name | N-butyl-2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 53088619 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-butyl-2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazine-6-carboxamide |
| SMILES | CCCCNC(=O)c1nn(-c2ccc(Cl)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H17ClN4O3/c1-3-4-9-17-13(21)12-14(22)19(2)15(23)20(18-12)11-7-5-10(16)6-8-11/h5-8H,3-4,9H2,1-2H3,(H,17,21) |
| InChIKey | SZBVVDYCUWKHCN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|