About 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide
4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 5308862) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide.
Molecular Properties
| Compound Name | 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide |
| PubChem CID | 5308862 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CCOc1ccc(-c2cc(CCCC(=O)NCc3cccnc3)no2)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-2-26-19-10-8-17(9-11-19)20-13-18(24-27-20)6-3-7-21(25)23-15-16-5-4-12-22-14-16/h4-5,8-14H,2-3,6-7,15H2,1H3,(H,23,25) |
| InChIKey | RMXSQFGUZZHXRB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide?
The IUPAC name of 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide (CID 5308862) is 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide.
What is the SMILES notation for 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide?
The canonical SMILES for 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide is CCOc1ccc(-c2cc(CCCC(=O)NCc3cccnc3)no2)cc1.
What is the InChIKey of 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide?
The InChIKey is RMXSQFGUZZHXRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3/c1-2-26-19-10-8-17(9-11-19)20-13-18(24-27-20)6-3-7-21(25)23-15-16-5-4-12-22-14-16/h4-5,8-14H,2-3,6-7,15H2,1H3,(H,23,25).
What are the key properties of 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide?
4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide has a molecular weight of 365.43 g/mol, XLogP of 3.77, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]-N-(pyridin-3-ylmethyl)butanamide is sourced from PubChem (CID 5308862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).