C24H22N2O4 — CID 53089373
2-benzyl-N-[(3,4-dimethoxyphenyl)methyl]-1,3-benzoxazole-6-carboxamide (PubChem CID 53089373) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-benzyl-N-[(3,4-dimethoxyphenyl)methyl]-1,3-benzoxazole-6-carboxamide.
| Compound Name | 2-benzyl-N-[(3,4-dimethoxyphenyl)methyl]-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 53089373 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-benzyl-N-[(3,4-dimethoxyphenyl)methyl]-1,3-benzoxazole-6-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc3nc(Cc4ccccc4)oc3c2)cc1OC |
| InChI | InChI=1S/C24H22N2O4/c1-28-20-11-8-17(12-22(20)29-2)15-25-24(27)18-9-10-19-21(14-18)30-23(26-19)13-16-6-4-3-5-7-16/h3-12,14H,13,15H2,1-2H3,(H,25,27) |
| InChIKey | XCTZSSWHUFAWBS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |