About N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide
N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 5308964) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 5308964 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCCC2)on1 |
| InChI | InChI=1S/C10H14N2O2/c1-7-6-9(14-12-7)10(13)11-8-4-2-3-5-8/h6,8H,2-5H2,1H3,(H,11,13) |
| InChIKey | IOTZNKBACRLQFW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide (CID 5308964) is N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide is Cc1cc(C(=O)NC2CCCC2)on1.
What is the InChIKey of N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is IOTZNKBACRLQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-7-6-9(14-12-7)10(13)11-8-4-2-3-5-8/h6,8H,2-5H2,1H3,(H,11,13).
What are the key properties of N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide?
N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 194.23 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-3-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 5308964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).