C16H22N2O5S — CID 5308982
2-(2,2-dimethyl-1,1,4-trioxo-3H-1λ6,5-benzothiazepin-5-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 5308982) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,1,4-trioxo-3H-1λ6,5-benzothiazepin-5-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(2,2-dimethyl-1,1,4-trioxo-3H-1λ6,5-benzothiazepin-5-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 5308982 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(2,2-dimethyl-1,1,4-trioxo-3H-1λ6,5-benzothiazepin-5-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1C(=O)CC(C)(C)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C16H22N2O5S/c1-16(2)10-15(20)18(11-14(19)17-8-9-23-3)12-6-4-5-7-13(12)24(16,21)22/h4-7H,8-11H2,1-3H3,(H,17,19) |
| InChIKey | OOFDJCZWEDLARK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|