C21H30N4O — CID 5309042
N-[3-(N-ethyl-3-methylanilino)propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide (PubChem CID 5309042) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[3-(N-ethyl-3-methylanilino)propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide.
| Compound Name | N-[3-(N-ethyl-3-methylanilino)propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5309042 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | N-[3-(N-ethyl-3-methylanilino)propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide |
| SMILES | CCN(CCCNC(=O)Cn1cc2c(n1)CCCC2)c1cccc(C)c1 |
| InChI | InChI=1S/C21H30N4O/c1-3-24(19-10-6-8-17(2)14-19)13-7-12-22-21(26)16-25-15-18-9-4-5-11-20(18)23-25/h6,8,10,14-15H,3-5,7,9,11-13,16H2,1-2H3,(H,22,26) |
| InChIKey | SGLCIXBUBRFQBP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|