About ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate
ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate (PubChem CID 53090669) has the molecular formula C19H30N2O3
and a molecular weight of 334.46 g/mol. Its IUPAC name is ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate |
| PubChem CID | 53090669 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(CCC(=O)N2CCCCC2)n(CC)c1C |
| InChI | InChI=1S/C19H30N2O3/c1-5-21-15(4)18(19(23)24-6-2)14(3)16(21)10-11-17(22)20-12-8-7-9-13-20/h5-13H2,1-4H3 |
| InChIKey | LPMDNFGBZHMDNG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate?
The IUPAC name of ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate (CID 53090669) is ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate.
What is the SMILES notation for ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate?
The canonical SMILES for ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate is CCOC(=O)c1c(C)c(CCC(=O)N2CCCCC2)n(CC)c1C.
What is the InChIKey of ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate?
The InChIKey is LPMDNFGBZHMDNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O3/c1-5-21-15(4)18(19(23)24-6-2)14(3)16(21)10-11-17(22)20-12-8-7-9-13-20/h5-13H2,1-4H3.
What are the key properties of ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate?
ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate has a molecular weight of 334.46 g/mol, XLogP of 3.25, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-ethyl-2,4-dimethyl-5-(3-oxo-3-piperidin-1-ylpropyl)pyrrole-3-carboxylate is sourced from PubChem (CID 53090669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).