C27H29N5O3 — CID 53091020
4-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]-N-(4-methylphenyl)-3-oxo-2H-quinoxaline-1-carboxamide (PubChem CID 53091020) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]-N-(4-methylphenyl)-3-oxo-2H-quinoxaline-1-carboxamide.
| Compound Name | 4-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]-N-(4-methylphenyl)-3-oxo-2H-quinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 53091020 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]-N-(4-methylphenyl)-3-oxo-2H-quinoxaline-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CC(=O)N(CC(=O)NCc3ccc(N(C)C)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H29N5O3/c1-19-8-12-21(13-9-19)29-27(35)32-18-26(34)31(23-6-4-5-7-24(23)32)17-25(33)28-16-20-10-14-22(15-11-20)30(2)3/h4-15H,16-18H2,1-3H3,(H,28,33)(H,29,35) |
| InChIKey | AUIJMNKDCWTRCC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|