C24H26FN5O4 — CID 53091048
N-(4-fluorophenyl)-3-oxo-4-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl]-2H-quinoxaline-1-carboxamide (PubChem CID 53091048) has the molecular formula C24H26FN5O4 and a molecular weight of 467.50 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-oxo-4-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl]-2H-quinoxaline-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-3-oxo-4-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl]-2H-quinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 53091048 |
| Molecular Formula | C24H26FN5O4 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-(4-fluorophenyl)-3-oxo-4-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl]-2H-quinoxaline-1-carboxamide |
| SMILES | O=C(CN1C(=O)CN(C(=O)Nc2ccc(F)cc2)c2ccccc21)NCCCN1CCCC1=O |
| InChI | InChI=1S/C24H26FN5O4/c25-17-8-10-18(11-9-17)27-24(34)30-16-23(33)29(19-5-1-2-6-20(19)30)15-21(31)26-12-4-14-28-13-3-7-22(28)32/h1-2,5-6,8-11H,3-4,7,12-16H2,(H,26,31)(H,27,34) |
| InChIKey | QIBMESGKYJWYHL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|