About tributyl-(3,5-difluorophenoxy)silane
tributyl-(3,5-difluorophenoxy)silane (PubChem CID 530918) has the molecular formula C18H30F2OSi
and a molecular weight of 328.52 g/mol. Its IUPAC name is tributyl-(3,5-difluorophenoxy)silane.
Molecular Properties
| Compound Name | tributyl-(3,5-difluorophenoxy)silane |
| PubChem CID | 530918 |
| Molecular Formula | C18H30F2OSi |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | tributyl-(3,5-difluorophenoxy)silane |
| SMILES | CCCC[Si](CCCC)(CCCC)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H30F2OSi/c1-4-7-10-22(11-8-5-2,12-9-6-3)21-18-14-16(19)13-17(20)15-18/h13-15H,4-12H2,1-3H3 |
| InChIKey | WRSJRQHALWDYOG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tributyl-(3,5-difluorophenoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(3,5-difluorophenoxy)silane?
The IUPAC name of tributyl-(3,5-difluorophenoxy)silane (CID 530918) is tributyl-(3,5-difluorophenoxy)silane.
What is the SMILES notation for tributyl-(3,5-difluorophenoxy)silane?
The canonical SMILES for tributyl-(3,5-difluorophenoxy)silane is CCCC[Si](CCCC)(CCCC)Oc1cc(F)cc(F)c1.
What is the InChIKey of tributyl-(3,5-difluorophenoxy)silane?
The InChIKey is WRSJRQHALWDYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30F2OSi/c1-4-7-10-22(11-8-5-2,12-9-6-3)21-18-14-16(19)13-17(20)15-18/h13-15H,4-12H2,1-3H3.
What are the key properties of tributyl-(3,5-difluorophenoxy)silane?
tributyl-(3,5-difluorophenoxy)silane has a molecular weight of 328.52 g/mol, XLogP of 6.69, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(3,5-difluorophenoxy)silane is sourced from PubChem (CID 530918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).