About 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide
6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide (PubChem CID 53092195) has the molecular formula C17H18ClN3O3S
and a molecular weight of 379.87 g/mol. Its IUPAC name is 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide |
| PubChem CID | 53092195 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide |
| SMILES | Cc1ccc(CNS(=O)(=O)c2cc3c(cc2Cl)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C17H18ClN3O3S/c1-11-4-6-12(7-5-11)10-19-25(23,24)16-9-15-14(8-13(16)18)20(2)17(22)21(15)3/h4-9,19H,10H2,1-3H3 |
| InChIKey | IENJRPUXZUNGQV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide?
The IUPAC name of 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide (CID 53092195) is 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide.
What is the SMILES notation for 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide?
The canonical SMILES for 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide is Cc1ccc(CNS(=O)(=O)c2cc3c(cc2Cl)n(C)c(=O)n3C)cc1.
What is the InChIKey of 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide?
The InChIKey is IENJRPUXZUNGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3O3S/c1-11-4-6-12(7-5-11)10-19-25(23,24)16-9-15-14(8-13(16)18)20(2)17(22)21(15)3/h4-9,19H,10H2,1-3H3.
What are the key properties of 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide?
6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide has a molecular weight of 379.87 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,3-dimethyl-N-[(4-methylphenyl)methyl]-2-oxobenzimidazole-5-sulfonamide is sourced from PubChem (CID 53092195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).