About furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate
furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate (PubChem CID 53092732) has the molecular formula C24H21NO6
and a molecular weight of 419.43 g/mol. Its IUPAC name is furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate.
Molecular Properties
| Compound Name | furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate |
| PubChem CID | 53092732 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate |
| SMILES | COc1cc2c(C(=O)OCc3ccco3)cn(-c3ccc(C)cc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C24H21NO6/c1-15-6-8-16(9-7-15)25-13-20(24(27)31-14-17-5-4-10-30-17)18-11-21(28-2)22(29-3)12-19(18)23(25)26/h4-13H,14H2,1-3H3 |
| InChIKey | HAJMLFBPKDHYLZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate?
The IUPAC name of furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate (CID 53092732) is furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate.
What is the SMILES notation for furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate?
The canonical SMILES for furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate is COc1cc2c(C(=O)OCc3ccco3)cn(-c3ccc(C)cc3)c(=O)c2cc1OC.
What is the InChIKey of furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate?
The InChIKey is HAJMLFBPKDHYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21NO6/c1-15-6-8-16(9-7-15)25-13-20(24(27)31-14-17-5-4-10-30-17)18-11-21(28-2)22(29-3)12-19(18)23(25)26/h4-13H,14H2,1-3H3.
What are the key properties of furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate?
furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate has a molecular weight of 419.43 g/mol, XLogP of 4.27, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl 6,7-dimethoxy-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylate is sourced from PubChem (CID 53092732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).