C22H25N7O — CID 53093152
N-[(2,5-dimethylphenyl)methyl]-3-[3,5-dimethyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)pyrazol-4-yl]propanamide (PubChem CID 53093152) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]-3-[3,5-dimethyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)pyrazol-4-yl]propanamide.
| Compound Name | N-[(2,5-dimethylphenyl)methyl]-3-[3,5-dimethyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)pyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 53093152 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-[(2,5-dimethylphenyl)methyl]-3-[3,5-dimethyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)pyrazol-4-yl]propanamide |
| SMILES | Cc1ccc(C)c(CNC(=O)CCc2c(C)nn(-c3ccc4nncn4n3)c2C)c1 |
| InChI | InChI=1S/C22H25N7O/c1-14-5-6-15(2)18(11-14)12-23-22(30)10-7-19-16(3)26-29(17(19)4)21-9-8-20-25-24-13-28(20)27-21/h5-6,8-9,11,13H,7,10,12H2,1-4H3,(H,23,30) |
| InChIKey | JDMUDKLHAZAURK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |