About 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol
4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol (PubChem CID 5309317) has the molecular formula C19H16N4O2
and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol.
Molecular Properties
| Compound Name | 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol |
| PubChem CID | 5309317 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol |
| SMILES | COc1cc(-c2nc3cnccn3c2Nc2ccccc2)ccc1O |
| InChI | InChI=1S/C19H16N4O2/c1-25-16-11-13(7-8-15(16)24)18-19(21-14-5-3-2-4-6-14)23-10-9-20-12-17(23)22-18/h2-12,21,24H,1H3 |
| InChIKey | KZMVPUIBSUVYJZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol?
The IUPAC name of 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol (CID 5309317) is 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol.
What is the SMILES notation for 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol?
The canonical SMILES for 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol is COc1cc(-c2nc3cnccn3c2Nc2ccccc2)ccc1O.
What is the InChIKey of 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol?
The InChIKey is KZMVPUIBSUVYJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2/c1-25-16-11-13(7-8-15(16)24)18-19(21-14-5-3-2-4-6-14)23-10-9-20-12-17(23)22-18/h2-12,21,24H,1H3.
What are the key properties of 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol?
4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol has a molecular weight of 332.36 g/mol, XLogP of 3.85, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol is sourced from PubChem (CID 5309317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).