C24H29N5O2S — CID 53093497
4-methyl-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-6-piperidin-1-ylpyrimidine (PubChem CID 53093497) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is 4-methyl-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-6-piperidin-1-ylpyrimidine.
| Compound Name | 4-methyl-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-6-piperidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 53093497 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 4-methyl-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-6-piperidin-1-ylpyrimidine |
| SMILES | Cc1cc(N2CCCCC2)nc(N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)n1 |
| InChI | InChI=1S/C24H29N5O2S/c1-19-17-23(27-11-5-2-6-12-27)26-24(25-19)28-13-15-29(16-14-28)32(30,31)22-10-9-20-7-3-4-8-21(20)18-22/h3-4,7-10,17-18H,2,5-6,11-16H2,1H3 |
| InChIKey | PMNNDXYKXYXJLY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |