About N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide
N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide (PubChem CID 53093612) has the molecular formula C19H20N2O2
and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide.
Molecular Properties
| Compound Name | N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide |
| PubChem CID | 53093612 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide |
| SMILES | CCC(=O)N1CCc2cc(CNC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C19H20N2O2/c1-2-18(22)21-11-10-16-12-14(8-9-17(16)21)13-20-19(23)15-6-4-3-5-7-15/h3-9,12H,2,10-11,13H2,1H3,(H,20,23) |
| InChIKey | VDXFVZSVOCOALV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide?
The IUPAC name of N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide (CID 53093612) is N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide.
What is the SMILES notation for N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide?
The canonical SMILES for N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide is CCC(=O)N1CCc2cc(CNC(=O)c3ccccc3)ccc21.
What is the InChIKey of N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide?
The InChIKey is VDXFVZSVOCOALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2/c1-2-18(22)21-11-10-16-12-14(8-9-17(16)21)13-20-19(23)15-6-4-3-5-7-15/h3-9,12H,2,10-11,13H2,1H3,(H,20,23).
What are the key properties of N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide?
N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide has a molecular weight of 308.38 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-propanoyl-2,3-dihydroindol-5-yl)methyl]benzamide is sourced from PubChem (CID 53093612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).