C20H23N3O4S — CID 53094849
N-[[4-(dimethylamino)phenyl]methyl]-2-methoxy-4-(3-methyl-1,2-oxazol-5-yl)benzenesulfonamide (PubChem CID 53094849) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-methoxy-4-(3-methyl-1,2-oxazol-5-yl)benzenesulfonamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-methoxy-4-(3-methyl-1,2-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 53094849 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-methoxy-4-(3-methyl-1,2-oxazol-5-yl)benzenesulfonamide |
| SMILES | COc1cc(-c2cc(C)no2)ccc1S(=O)(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H23N3O4S/c1-14-11-18(27-22-14)16-7-10-20(19(12-16)26-4)28(24,25)21-13-15-5-8-17(9-6-15)23(2)3/h5-12,21H,13H2,1-4H3 |
| InChIKey | JLIZVHVSSPDYCD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|