About 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride
1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride (PubChem CID 5309506) has the molecular formula C18H27ClN2O2
and a molecular weight of 338.88 g/mol. Its IUPAC name is 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride |
| PubChem CID | 5309506 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride |
| SMILES | Cc1ccc2c(c1)c(C)c(C)n2CC(O)CN1CCOCC1.Cl |
| InChI | InChI=1S/C18H26N2O2.ClH/c1-13-4-5-18-17(10-13)14(2)15(3)20(18)12-16(21)11-19-6-8-22-9-7-19;/h4-5,10,16,21H,6-9,11-12H2,1-3H3;1H |
| InChIKey | LMZRBKOHMGYJIU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride?
The IUPAC name of 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride (CID 5309506) is 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride.
What is the SMILES notation for 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride?
The canonical SMILES for 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride is Cc1ccc2c(c1)c(C)c(C)n2CC(O)CN1CCOCC1.Cl.
What is the InChIKey of 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride?
The InChIKey is LMZRBKOHMGYJIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O2.ClH/c1-13-4-5-18-17(10-13)14(2)15(3)20(18)12-16(21)11-19-6-8-22-9-7-19;/h4-5,10,16,21H,6-9,11-12H2,1-3H3;1H.
What are the key properties of 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride?
1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride has a molecular weight of 338.88 g/mol, XLogP of 2.68, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol;hydrochloride is sourced from PubChem (CID 5309506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).