C18H21BrO2 — CID 530951
2,6-dimethylnon-1-en-3-yn-5-yl 3-bromobenzoate (PubChem CID 530951) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is 2,6-dimethylnon-1-en-3-yn-5-yl 3-bromobenzoate.
| Compound Name | 2,6-dimethylnon-1-en-3-yn-5-yl 3-bromobenzoate |
|---|---|
| PubChem CID | 530951 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2,6-dimethylnon-1-en-3-yn-5-yl 3-bromobenzoate |
| SMILES | C=C(C)C#CC(OC(=O)c1cccc(Br)c1)C(C)CCC |
| InChI | InChI=1S/C18H21BrO2/c1-5-7-14(4)17(11-10-13(2)3)21-18(20)15-8-6-9-16(19)12-15/h6,8-9,12,14,17H,2,5,7H2,1,3-4H3 |
| InChIKey | XFEWWWKVYNRMDB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|