C20H28N2O5 — CID 5309615
ethyl 2-[6-(cycloheptylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]acetate (PubChem CID 5309615) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is ethyl 2-[6-(cycloheptylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]acetate.
| Compound Name | ethyl 2-[6-(cycloheptylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]acetate |
|---|---|
| PubChem CID | 5309615 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | ethyl 2-[6-(cycloheptylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]acetate |
| SMILES | CCOC(=O)CN1CC23C=CC(O2)C(C(=O)NC2CCCCCC2)C3C1=O |
| InChI | InChI=1S/C20H28N2O5/c1-2-26-15(23)11-22-12-20-10-9-14(27-20)16(17(20)19(22)25)18(24)21-13-7-5-3-4-6-8-13/h9-10,13-14,16-17H,2-8,11-12H2,1H3,(H,21,24) |
| InChIKey | SQJSWAJBXNKLHP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|