C17H22N2O2 — CID 5309620
1-(1-acetyl-2,3-dihydroindol-5-yl)-2-piperidin-1-ylethanone (PubChem CID 5309620) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(1-acetyl-2,3-dihydroindol-5-yl)-2-piperidin-1-ylethanone.
| Compound Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 5309620 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-2-piperidin-1-ylethanone |
| SMILES | CC(=O)N1CCc2cc(C(=O)CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C17H22N2O2/c1-13(20)19-10-7-14-11-15(5-6-16(14)19)17(21)12-18-8-3-2-4-9-18/h5-6,11H,2-4,7-10,12H2,1H3 |
| InChIKey | PAJVKUUQFSPKHP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |