C24H22N2O5S — CID 53096516
4-(benzenesulfonyl)-N-(3-prop-2-enoxyphenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 53096516) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(3-prop-2-enoxyphenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-N-(3-prop-2-enoxyphenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 53096516 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(3-prop-2-enoxyphenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | C=CCOc1cccc(NC(=O)C2CN(S(=O)(=O)c3ccccc3)c3ccccc3O2)c1 |
| InChI | InChI=1S/C24H22N2O5S/c1-2-15-30-19-10-8-9-18(16-19)25-24(27)23-17-26(21-13-6-7-14-22(21)31-23)32(28,29)20-11-4-3-5-12-20/h2-14,16,23H,1,15,17H2,(H,25,27) |
| InChIKey | WFBCMLPULSONIQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|