C24H22N2O6S — CID 53097365
2-methyl-8-morpholin-4-ylsulfonyl-9-phenoxy-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 53097365) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-methyl-8-morpholin-4-ylsulfonyl-9-phenoxy-5H-benzo[b][1,4]benzoxazepin-6-one.
| Compound Name | 2-methyl-8-morpholin-4-ylsulfonyl-9-phenoxy-5H-benzo[b][1,4]benzoxazepin-6-one |
|---|---|
| PubChem CID | 53097365 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-methyl-8-morpholin-4-ylsulfonyl-9-phenoxy-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | Cc1ccc2c(c1)Oc1cc(Oc3ccccc3)c(S(=O)(=O)N3CCOCC3)cc1C(=O)N2 |
| InChI | InChI=1S/C24H22N2O6S/c1-16-7-8-19-21(13-16)32-20-15-22(31-17-5-3-2-4-6-17)23(14-18(20)24(27)25-19)33(28,29)26-9-11-30-12-10-26/h2-8,13-15H,9-12H2,1H3,(H,25,27) |
| InChIKey | DPOGHBYZONDPFJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |