C22H30FN5O — CID 5309752
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide (PubChem CID 5309752) has the molecular formula C22H30FN5O and a molecular weight of 399.51 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5309752 |
| Molecular Formula | C22H30FN5O |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-(4,5,6,7-tetrahydroindazol-2-yl)acetamide |
| SMILES | O=C(Cn1cc2c(n1)CCCC2)NCCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H30FN5O/c23-19-7-2-4-9-21(19)27-14-12-26(13-15-27)11-5-10-24-22(29)17-28-16-18-6-1-3-8-20(18)25-28/h2,4,7,9,16H,1,3,5-6,8,10-15,17H2,(H,24,29) |
| InChIKey | YAPNXZABQCZMNS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|