C22H24N4O4 — CID 53097740
2-[3-[acetyl(methyl)amino]-2-oxoquinoxalin-1-yl]-N-(3-methoxyphenyl)butanamide (PubChem CID 53097740) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-[3-[acetyl(methyl)amino]-2-oxoquinoxalin-1-yl]-N-(3-methoxyphenyl)butanamide.
| Compound Name | 2-[3-[acetyl(methyl)amino]-2-oxoquinoxalin-1-yl]-N-(3-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 53097740 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[3-[acetyl(methyl)amino]-2-oxoquinoxalin-1-yl]-N-(3-methoxyphenyl)butanamide |
| SMILES | CCC(C(=O)Nc1cccc(OC)c1)n1c(=O)c(N(C)C(C)=O)nc2ccccc21 |
| InChI | InChI=1S/C22H24N4O4/c1-5-18(21(28)23-15-9-8-10-16(13-15)30-4)26-19-12-7-6-11-17(19)24-20(22(26)29)25(3)14(2)27/h6-13,18H,5H2,1-4H3,(H,23,28) |
| InChIKey | MLPVOZXMYJKXCB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |