C11H5F5O2 — CID 530986
but-3-yn-2-yl 2,3,4,5,6-pentafluorobenzoate (PubChem CID 530986) has the molecular formula C11H5F5O2 and a molecular weight of 264.15 g/mol. Its IUPAC name is but-3-yn-2-yl 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | but-3-yn-2-yl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 530986 |
| Molecular Formula | C11H5F5O2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | but-3-yn-2-yl 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C#CC(C)OC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H5F5O2/c1-3-4(2)18-11(17)5-6(12)8(14)10(16)9(15)7(5)13/h1,4H,2H3 |
| InChIKey | KWGBKJUEKIANIM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|