C23H18ClFN2O2 — CID 53099088
N-[[1-(4-chlorobenzoyl)-2,3-dihydroindol-6-yl]methyl]-2-fluorobenzamide (PubChem CID 53099088) has the molecular formula C23H18ClFN2O2 and a molecular weight of 408.86 g/mol. Its IUPAC name is N-[[1-(4-chlorobenzoyl)-2,3-dihydroindol-6-yl]methyl]-2-fluorobenzamide.
| Compound Name | N-[[1-(4-chlorobenzoyl)-2,3-dihydroindol-6-yl]methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 53099088 |
| Molecular Formula | C23H18ClFN2O2 |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-[[1-(4-chlorobenzoyl)-2,3-dihydroindol-6-yl]methyl]-2-fluorobenzamide |
| SMILES | O=C(NCc1ccc2c(c1)N(C(=O)c1ccc(Cl)cc1)CC2)c1ccccc1F |
| InChI | InChI=1S/C23H18ClFN2O2/c24-18-9-7-17(8-10-18)23(29)27-12-11-16-6-5-15(13-21(16)27)14-26-22(28)19-3-1-2-4-20(19)25/h1-10,13H,11-12,14H2,(H,26,28) |
| InChIKey | HJPCSHKDBIEZNE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |