C21H25N3O2 — CID 53099492
1-[[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]methyl]-3-propan-2-ylurea (PubChem CID 53099492) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]methyl]-3-propan-2-ylurea.
| Compound Name | 1-[[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 53099492 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]methyl]-3-propan-2-ylurea |
| SMILES | Cc1ccc(C(=O)N2CCc3ccc(CNC(=O)NC(C)C)cc32)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-14(2)23-21(26)22-13-16-6-9-17-10-11-24(19(17)12-16)20(25)18-7-4-15(3)5-8-18/h4-9,12,14H,10-11,13H2,1-3H3,(H2,22,23,26) |
| InChIKey | GGESEIQJOXPEPU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |