C27H26N2O5 — CID 53101742
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6,6-dimethyl-2-(4-methylphenyl)-3,8-dioxo-5,7-dihydroisoquinoline-4-carboxamide (PubChem CID 53101742) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6,6-dimethyl-2-(4-methylphenyl)-3,8-dioxo-5,7-dihydroisoquinoline-4-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6,6-dimethyl-2-(4-methylphenyl)-3,8-dioxo-5,7-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 53101742 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6,6-dimethyl-2-(4-methylphenyl)-3,8-dioxo-5,7-dihydroisoquinoline-4-carboxamide |
| SMILES | Cc1ccc(-n2cc3c(c(C(=O)Nc4ccc5c(c4)OCCO5)c2=O)CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C27H26N2O5/c1-16-4-7-18(8-5-16)29-15-20-19(13-27(2,3)14-21(20)30)24(26(29)32)25(31)28-17-6-9-22-23(12-17)34-11-10-33-22/h4-9,12,15H,10-11,13-14H2,1-3H3,(H,28,31) |
| InChIKey | OVUFYSWHBSBYQS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |