C10H8N2O3S — CID 5310257
N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)acetamide (PubChem CID 5310257) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)acetamide.
| Compound Name | N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)acetamide |
|---|---|
| PubChem CID | 5310257 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)acetamide |
| SMILES | CC(=O)Nc1nc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C10H8N2O3S/c1-5(13)11-10-12-6-2-7-8(15-4-14-7)3-9(6)16-10/h2-3H,4H2,1H3,(H,11,12,13) |
| InChIKey | GHHCOWNHIDMODL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |