C24H24N2O3S — CID 53102668
N-[(1-benzoyl-2,3-dihydroindol-6-yl)methyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 53102668) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is N-[(1-benzoyl-2,3-dihydroindol-6-yl)methyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(1-benzoyl-2,3-dihydroindol-6-yl)methyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 53102668 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[(1-benzoyl-2,3-dihydroindol-6-yl)methyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccc3c(c2)N(C(=O)c2ccccc2)CC3)cc1C |
| InChI | InChI=1S/C24H24N2O3S/c1-17-8-11-22(14-18(17)2)30(28,29)25-16-19-9-10-20-12-13-26(23(20)15-19)24(27)21-6-4-3-5-7-21/h3-11,14-15,25H,12-13,16H2,1-2H3 |
| InChIKey | CIUKSNBBCJUFLA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |