About 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide
5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide (PubChem CID 53102847) has the molecular formula C15H11F3N2O4S2
and a molecular weight of 404.39 g/mol. Its IUPAC name is 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide |
| PubChem CID | 53102847 |
| Molecular Formula | C15H11F3N2O4S2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1ncc(-c2ccc(S(=O)(=O)Nc3ccc(OC(F)(F)F)cc3)s2)o1 |
| InChI | InChI=1S/C15H11F3N2O4S2/c1-9-19-8-12(23-9)13-6-7-14(25-13)26(21,22)20-10-2-4-11(5-3-10)24-15(16,17)18/h2-8,20H,1H3 |
| InChIKey | KLGASWBXFOCOEU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
The IUPAC name of 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide (CID 53102847) is 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide is Cc1ncc(-c2ccc(S(=O)(=O)Nc3ccc(OC(F)(F)F)cc3)s2)o1.
What is the InChIKey of 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
The InChIKey is KLGASWBXFOCOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3N2O4S2/c1-9-19-8-12(23-9)13-6-7-14(25-13)26(21,22)20-10-2-4-11(5-3-10)24-15(16,17)18/h2-8,20H,1H3.
What are the key properties of 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide has a molecular weight of 404.39 g/mol, XLogP of 4.41, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide is sourced from PubChem (CID 53102847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).