About 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide
5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide (PubChem CID 53102943) has the molecular formula C17H13F3N2O4S2
and a molecular weight of 430.43 g/mol. Its IUPAC name is 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide |
| PubChem CID | 53102943 |
| Molecular Formula | C17H13F3N2O4S2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OC(F)(F)F)cc1)c1ccc(-c2cnc(C3CC3)o2)s1 |
| InChI | InChI=1S/C17H13F3N2O4S2/c18-17(19,20)26-12-5-3-11(4-6-12)22-28(23,24)15-8-7-14(27-15)13-9-21-16(25-13)10-1-2-10/h3-10,22H,1-2H2 |
| InChIKey | XEGJTGXXFGCPAW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
The IUPAC name of 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide (CID 53102943) is 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide is O=S(=O)(Nc1ccc(OC(F)(F)F)cc1)c1ccc(-c2cnc(C3CC3)o2)s1.
What is the InChIKey of 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
The InChIKey is XEGJTGXXFGCPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N2O4S2/c18-17(19,20)26-12-5-3-11(4-6-12)22-28(23,24)15-8-7-14(27-15)13-9-21-16(25-13)10-1-2-10/h3-10,22H,1-2H2.
What are the key properties of 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide has a molecular weight of 430.43 g/mol, XLogP of 4.98, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide is sourced from PubChem (CID 53102943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).