About 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide
5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide (PubChem CID 53103047) has the molecular formula C17H18N2O4S2
and a molecular weight of 378.48 g/mol. Its IUPAC name is 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide |
| PubChem CID | 53103047 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(CNS(=O)(=O)c2ccc(-c3cnc(C4CCC4)o3)s2)o1 |
| InChI | InChI=1S/C17H18N2O4S2/c1-11-5-6-13(22-11)9-19-25(20,21)16-8-7-15(24-16)14-10-18-17(23-14)12-3-2-4-12/h5-8,10,12,19H,2-4,9H2,1H3 |
| InChIKey | JGYPABFTXOZKAS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide?
The IUPAC name of 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide (CID 53103047) is 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide is Cc1ccc(CNS(=O)(=O)c2ccc(-c3cnc(C4CCC4)o3)s2)o1.
What is the InChIKey of 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide?
The InChIKey is JGYPABFTXOZKAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4S2/c1-11-5-6-13(22-11)9-19-25(20,21)16-8-7-15(24-16)14-10-18-17(23-14)12-3-2-4-12/h5-8,10,12,19H,2-4,9H2,1H3.
What are the key properties of 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide?
5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide has a molecular weight of 378.48 g/mol, XLogP of 4.05, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclobutyl-1,3-oxazol-5-yl)-N-[(5-methylfuran-2-yl)methyl]thiophene-2-sulfonamide is sourced from PubChem (CID 53103047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).