About 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide
5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide (PubChem CID 53103164) has the molecular formula C19H17F3N2O4S2
and a molecular weight of 458.48 g/mol. Its IUPAC name is 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide |
| PubChem CID | 53103164 |
| Molecular Formula | C19H17F3N2O4S2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OC(F)(F)F)cc1)c1ccc(-c2cnc(C3CCCC3)o2)s1 |
| InChI | InChI=1S/C19H17F3N2O4S2/c20-19(21,22)28-14-7-5-13(6-8-14)24-30(25,26)17-10-9-16(29-17)15-11-23-18(27-15)12-3-1-2-4-12/h5-12,24H,1-4H2 |
| InChIKey | SAUDMIWQNMIWTR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
The IUPAC name of 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide (CID 53103164) is 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide is O=S(=O)(Nc1ccc(OC(F)(F)F)cc1)c1ccc(-c2cnc(C3CCCC3)o2)s1.
What is the InChIKey of 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
The InChIKey is SAUDMIWQNMIWTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3N2O4S2/c20-19(21,22)28-14-7-5-13(6-8-14)24-30(25,26)17-10-9-16(29-17)15-11-23-18(27-15)12-3-1-2-4-12/h5-12,24H,1-4H2.
What are the key properties of 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide?
5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide has a molecular weight of 458.48 g/mol, XLogP of 5.76, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclopentyl-1,3-oxazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide is sourced from PubChem (CID 53103164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).