C19H32N4OS — CID 5310349
1-Cyclohexyl-3-(1-(4-methylpiperazin-1-yl)-1-(thiophen-2-yl)propan-2-yl)urea (PubChem CID 5310349) has the molecular formula C19H32N4OS and a molecular weight of 364.60 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(4-methylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]urea.
| Compound Name | 1-Cyclohexyl-3-(1-(4-methylpiperazin-1-yl)-1-(thiophen-2-yl)propan-2-yl)urea |
|---|---|
| PubChem CID | 5310349 |
| Molecular Formula | C19H32N4OS |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 1-cyclohexyl-3-[1-(4-methylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]urea |
| SMILES | CC(C(C1=CC=CS1)N2CCN(CC2)C)NC(=O)NC3CCCCC3 |
| InChI | InChI=1S/C19H32N4OS/c1-15(20-19(24)21-16-7-4-3-5-8-16)18(17-9-6-14-25-17)23-12-10-22(2)11-13-23/h6,9,14-16,18H,3-5,7-8,10-13H2,1-2H3,(H2,20,21,24) |
| InChIKey | OLUIHRKTRXGAOK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 422 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |