About 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid
6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 5310449) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| PubChem CID | 5310449 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)NCc1cn2ccccc2n1 |
| InChI | InChI=1S/C16H17N3O3/c20-15(12-5-1-2-6-13(12)16(21)22)17-9-11-10-19-8-4-3-7-14(19)18-11/h1-4,7-8,10,12-13H,5-6,9H2,(H,17,20)(H,21,22) |
| InChIKey | TXYHTOSQRPCDIG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid?
The IUPAC name of 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (CID 5310449) is 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid is O=C(O)C1CC=CCC1C(=O)NCc1cn2ccccc2n1.
What is the InChIKey of 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid?
The InChIKey is TXYHTOSQRPCDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3/c20-15(12-5-1-2-6-13(12)16(21)22)17-9-11-10-19-8-4-3-7-14(19)18-11/h1-4,7-8,10,12-13H,5-6,9H2,(H,17,20)(H,21,22).
What are the key properties of 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid?
6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid has a molecular weight of 299.33 g/mol, XLogP of 1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(imidazo[1,2-a]pyridin-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 5310449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).