About methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate
methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate (PubChem CID 5310593) has the molecular formula C14H15N3O6S
and a molecular weight of 353.36 g/mol. Its IUPAC name is methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate.
Molecular Properties
| Compound Name | methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate |
| PubChem CID | 5310593 |
| Molecular Formula | C14H15N3O6S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H15N3O6S/c1-16-8-11(12(18)17(2)14(16)20)24(21,22)15-10-7-5-4-6-9(10)13(19)23-3/h4-8,15H,1-3H3 |
| InChIKey | AVOMJXCITJUJGV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate?
The IUPAC name of methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate (CID 5310593) is methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate.
What is the SMILES notation for methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate?
The canonical SMILES for methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate is COC(=O)c1ccccc1NS(=O)(=O)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate?
The InChIKey is AVOMJXCITJUJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O6S/c1-16-8-11(12(18)17(2)14(16)20)24(21,22)15-10-7-5-4-6-9(10)13(19)23-3/h4-8,15H,1-3H3.
What are the key properties of methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate?
methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate has a molecular weight of 353.36 g/mol, XLogP of -0.33, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]benzoate is sourced from PubChem (CID 5310593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).