About 3-methylcinnolin-5-amine
3-methylcinnolin-5-amine (PubChem CID 5310645) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 3-methylcinnolin-5-amine.
Molecular Properties
| Compound Name | 3-methylcinnolin-5-amine |
| PubChem CID | 5310645 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 3-methylcinnolin-5-amine |
| SMILES | Cc1cc2c(N)cccc2nn1 |
| InChI | InChI=1S/C9H9N3/c1-6-5-7-8(10)3-2-4-9(7)12-11-6/h2-5H,10H2,1H3 |
| InChIKey | HOJQDQQMHMVETF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methylcinnolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcinnolin-5-amine?
The IUPAC name of 3-methylcinnolin-5-amine (CID 5310645) is 3-methylcinnolin-5-amine.
What is the SMILES notation for 3-methylcinnolin-5-amine?
The canonical SMILES for 3-methylcinnolin-5-amine is Cc1cc2c(N)cccc2nn1.
What is the InChIKey of 3-methylcinnolin-5-amine?
The InChIKey is HOJQDQQMHMVETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c1-6-5-7-8(10)3-2-4-9(7)12-11-6/h2-5H,10H2,1H3.
What are the key properties of 3-methylcinnolin-5-amine?
3-methylcinnolin-5-amine has a molecular weight of 159.19 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcinnolin-5-amine is sourced from PubChem (CID 5310645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).