C13H21Cl3O2 — CID 531066
undec-2-enyl 2,2,2-trichloroacetate (PubChem CID 531066) has the molecular formula C13H21Cl3O2 and a molecular weight of 315.67 g/mol. Its IUPAC name is undec-2-enyl 2,2,2-trichloroacetate.
| Compound Name | undec-2-enyl 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 531066 |
| Molecular Formula | C13H21Cl3O2 |
| Molecular Weight | 315.67 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | undec-2-enyl 2,2,2-trichloroacetate |
| SMILES | CCCCCCCCC=CCOC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H21Cl3O2/c1-2-3-4-5-6-7-8-9-10-11-18-12(17)13(14,15)16/h9-10H,2-8,11H2,1H3 |
| InChIKey | HPCFGWRDJUTDBB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|