C17H22N4O6S — CID 53106637
4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2-methoxyethyl)-6-methyl-3-oxo-1,4-benzoxazine-7-sulfonamide (PubChem CID 53106637) has the molecular formula C17H22N4O6S and a molecular weight of 410.45 g/mol. Its IUPAC name is 4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2-methoxyethyl)-6-methyl-3-oxo-1,4-benzoxazine-7-sulfonamide.
| Compound Name | 4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2-methoxyethyl)-6-methyl-3-oxo-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 53106637 |
| Molecular Formula | C17H22N4O6S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2-methoxyethyl)-6-methyl-3-oxo-1,4-benzoxazine-7-sulfonamide |
| SMILES | CCc1nc(CN2C(=O)COc3cc(S(=O)(=O)NCCOC)c(C)cc32)no1 |
| InChI | InChI=1S/C17H22N4O6S/c1-4-16-19-15(20-27-16)9-21-12-7-11(2)14(8-13(12)26-10-17(21)22)28(23,24)18-5-6-25-3/h7-8,18H,4-6,9-10H2,1-3H3 |
| InChIKey | RKHHTQJZLBNBMA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|