C24H26N4O — CID 53107339
N-[(2-methylphenyl)methyl]-1-(5-phenylpyrimidin-2-yl)piperidine-4-carboxamide (PubChem CID 53107339) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-1-(5-phenylpyrimidin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-[(2-methylphenyl)methyl]-1-(5-phenylpyrimidin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53107339 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-1-(5-phenylpyrimidin-2-yl)piperidine-4-carboxamide |
| SMILES | Cc1ccccc1CNC(=O)C1CCN(c2ncc(-c3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C24H26N4O/c1-18-7-5-6-10-21(18)15-25-23(29)20-11-13-28(14-12-20)24-26-16-22(17-27-24)19-8-3-2-4-9-19/h2-10,16-17,20H,11-15H2,1H3,(H,25,29) |
| InChIKey | GNSVHLDABUUSTJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |