C19H24N4O3 — CID 53107440
N-benzyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 53107440) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-benzyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-benzyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53107440 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-benzyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | Cn1c(N2CCCC(C(=O)NCc3ccccc3)C2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C19H24N4O3/c1-21-16(11-17(24)22(2)19(21)26)23-10-6-9-15(13-23)18(25)20-12-14-7-4-3-5-8-14/h3-5,7-8,11,15H,6,9-10,12-13H2,1-2H3,(H,20,25) |
| InChIKey | PUEQREXWIRXPNV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |