C24H23FN4O4 — CID 53107933
N-[(4-butoxyphenyl)methyl]-2-[[3-(3-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]oxy]acetamide (PubChem CID 53107933) has the molecular formula C24H23FN4O4 and a molecular weight of 450.47 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-[[3-(3-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]oxy]acetamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-[[3-(3-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]oxy]acetamide |
|---|---|
| PubChem CID | 53107933 |
| Molecular Formula | C24H23FN4O4 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-[[3-(3-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]oxy]acetamide |
| SMILES | CCCCOc1ccc(CNC(=O)COc2ncnc3onc(-c4cccc(F)c4)c23)cc1 |
| InChI | InChI=1S/C24H23FN4O4/c1-2-3-11-31-19-9-7-16(8-10-19)13-26-20(30)14-32-23-21-22(17-5-4-6-18(25)12-17)29-33-24(21)28-15-27-23/h4-10,12,15H,2-3,11,13-14H2,1H3,(H,26,30) |
| InChIKey | KVUAIWPDHMJAJA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|